C8H14INO — CID 159631300
(1S,5R)-3-(aminomethyl)-1-(iodomethyl)-5-methylcyclopent-2-en-1-ol (PubChem CID 159631300) has the molecular formula C8H14INO and a molecular weight of 267.11 g/mol. Its IUPAC name is (1S,5R)-3-(aminomethyl)-1-(iodomethyl)-5-methylcyclopent-2-en-1-ol.
| Compound Name | (1S,5R)-3-(aminomethyl)-1-(iodomethyl)-5-methylcyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 159631300 |
| Molecular Formula | C8H14INO |
| Molecular Weight | 267.11 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | (1S,5R)-3-(aminomethyl)-1-(iodomethyl)-5-methylcyclopent-2-en-1-ol |
| SMILES | C[C@@H]1CC(CN)=C[C@]1(O)CI |
| InChI | InChI=1S/C8H14INO/c1-6-2-7(4-10)3-8(6,11)5-9/h3,6,11H,2,4-5,10H2,1H3/t6-,8+/m1/s1 |
| InChIKey | MPDWJWAINUQBEQ-SVRRBLITSA-N |
| XLogP | 1.08 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.11 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|