About 1-bromo-4-nitrobenzene;ethene;1-ethenyl-4-nitrobenzene
1-bromo-4-nitrobenzene;ethene;1-ethenyl-4-nitrobenzene (PubChem CID 159633304) has the molecular formula C16H15BrN2O4
and a molecular weight of 379.21 g/mol. Its IUPAC name is 1-bromo-4-nitrobenzene;ethene;1-ethenyl-4-nitrobenzene.
Molecular Properties
| Compound Name | 1-bromo-4-nitrobenzene;ethene;1-ethenyl-4-nitrobenzene |
| PubChem CID | 159633304 |
| Molecular Formula | C16H15BrN2O4 |
| Molecular Weight | 379.21 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 1-bromo-4-nitrobenzene;ethene;1-ethenyl-4-nitrobenzene |
| SMILES | C=C.C=Cc1ccc([N+](=O)[O-])cc1.O=[N+]([O-])c1ccc(Br)cc1 |
| InChI | InChI=1S/C8H7NO2.C6H4BrNO2.C2H4/c1-2-7-3-5-8(6-4-7)9(10)11;7-5-1-3-6(4-2-5)8(9)10;1-2/h2-6H,1H2;1-4H;1-2H2 |
| InChIKey | MPKKCYFTTRVGIF-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.21 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-nitrobenzene;ethene;1-ethenyl-4-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-nitrobenzene;ethene;1-ethenyl-4-nitrobenzene?
The IUPAC name of 1-bromo-4-nitrobenzene;ethene;1-ethenyl-4-nitrobenzene (CID 159633304) is 1-bromo-4-nitrobenzene;ethene;1-ethenyl-4-nitrobenzene.
What is the SMILES notation for 1-bromo-4-nitrobenzene;ethene;1-ethenyl-4-nitrobenzene?
The canonical SMILES for 1-bromo-4-nitrobenzene;ethene;1-ethenyl-4-nitrobenzene is C=C.C=Cc1ccc([N+](=O)[O-])cc1.O=[N+]([O-])c1ccc(Br)cc1.
What is the InChIKey of 1-bromo-4-nitrobenzene;ethene;1-ethenyl-4-nitrobenzene?
The InChIKey is MPKKCYFTTRVGIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2.C6H4BrNO2.C2H4/c1-2-7-3-5-8(6-4-7)9(10)11;7-5-1-3-6(4-2-5)8(9)10;1-2/h2-6H,1H2;1-4H;1-2H2.
What are the key properties of 1-bromo-4-nitrobenzene;ethene;1-ethenyl-4-nitrobenzene?
1-bromo-4-nitrobenzene;ethene;1-ethenyl-4-nitrobenzene has a molecular weight of 379.21 g/mol, XLogP of 5.40, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-nitrobenzene;ethene;1-ethenyl-4-nitrobenzene is sourced from PubChem (CID 159633304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).