C18H33N3O2 — CID 159633587
(13S)-17-[(1S)-1-methoxypropyl]-1,5,10-triazabicyclo[11.4.0]heptadec-14-en-11-one (PubChem CID 159633587) has the molecular formula C18H33N3O2 and a molecular weight of 323.48 g/mol. Its IUPAC name is (13S)-17-[(1S)-1-methoxypropyl]-1,5,10-triazabicyclo[11.4.0]heptadec-14-en-11-one.
| Compound Name | (13S)-17-[(1S)-1-methoxypropyl]-1,5,10-triazabicyclo[11.4.0]heptadec-14-en-11-one |
|---|---|
| PubChem CID | 159633587 |
| Molecular Formula | C18H33N3O2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | (13S)-17-[(1S)-1-methoxypropyl]-1,5,10-triazabicyclo[11.4.0]heptadec-14-en-11-one |
| SMILES | CC[C@H](OC)C1CC=C[C@@H]2CC(=O)NCCCCNCCCN12 |
| InChI | InChI=1S/C18H33N3O2/c1-3-17(23-2)16-9-6-8-15-14-18(22)20-12-5-4-10-19-11-7-13-21(15)16/h6,8,15-17,19H,3-5,7,9-14H2,1-2H3,(H,20,22)/t15-,16?,17+/m1/s1 |
| InChIKey | MPLKNNIBKFGTGK-SKQWJGTPSA-N |
| XLogP | 1.69 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|