About cyclopenta-1,3-diene;iron(2+);tributyl(cyclopenta-2,4-dien-1-yl)stannane
cyclopenta-1,3-diene;iron(2+);tributyl(cyclopenta-2,4-dien-1-yl)stannane (PubChem CID 15963367) has the molecular formula C22H36FeSn
and a molecular weight of 475.09 g/mol. Its IUPAC name is cyclopenta-1,3-diene;iron(2+);tributyl(cyclopenta-2,4-dien-1-yl)stannane.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;iron(2+);tributyl(cyclopenta-2,4-dien-1-yl)stannane |
| PubChem CID | 15963367 |
| Molecular Formula | C22H36FeSn |
| Molecular Weight | 475.09 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | cyclopenta-1,3-diene;iron(2+);tributyl(cyclopenta-2,4-dien-1-yl)stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)[c-]1cccc1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C5H5.C5H4.3C4H9.Fe.Sn/c2*1-2-4-5-3-1;3*1-3-4-2;;/h1-5H;1-4H;3*1,3-4H2,2H3;;/q2*-1;;;;+2; |
| InChIKey | INYNHAVBRMGGSH-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.09 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-diene;iron(2+);tributyl(cyclopenta-2,4-dien-1-yl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;iron(2+);tributyl(cyclopenta-2,4-dien-1-yl)stannane?
The IUPAC name of cyclopenta-1,3-diene;iron(2+);tributyl(cyclopenta-2,4-dien-1-yl)stannane (CID 15963367) is cyclopenta-1,3-diene;iron(2+);tributyl(cyclopenta-2,4-dien-1-yl)stannane.
What is the SMILES notation for cyclopenta-1,3-diene;iron(2+);tributyl(cyclopenta-2,4-dien-1-yl)stannane?
The canonical SMILES for cyclopenta-1,3-diene;iron(2+);tributyl(cyclopenta-2,4-dien-1-yl)stannane is CCCC[Sn](CCCC)(CCCC)[c-]1cccc1.[Fe+2].c1cc[cH-]c1.
What is the InChIKey of cyclopenta-1,3-diene;iron(2+);tributyl(cyclopenta-2,4-dien-1-yl)stannane?
The InChIKey is INYNHAVBRMGGSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5.C5H4.3C4H9.Fe.Sn/c2*1-2-4-5-3-1;3*1-3-4-2;;/h1-5H;1-4H;3*1,3-4H2,2H3;;/q2*-1;;;;+2;.
What are the key properties of cyclopenta-1,3-diene;iron(2+);tributyl(cyclopenta-2,4-dien-1-yl)stannane?
cyclopenta-1,3-diene;iron(2+);tributyl(cyclopenta-2,4-dien-1-yl)stannane has a molecular weight of 475.09 g/mol, XLogP of 6.86, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;iron(2+);tributyl(cyclopenta-2,4-dien-1-yl)stannane is sourced from PubChem (CID 15963367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).