About 6-(2-fluorophenyl)-3-methyl-2-methylidene-5-phenyl-3,4-dihydro-1H-pyridine
6-(2-fluorophenyl)-3-methyl-2-methylidene-5-phenyl-3,4-dihydro-1H-pyridine (PubChem CID 159633874) has the molecular formula C19H18FN
and a molecular weight of 279.36 g/mol. Its IUPAC name is 6-(2-fluorophenyl)-3-methyl-2-methylidene-5-phenyl-3,4-dihydro-1H-pyridine.
Molecular Properties
| Compound Name | 6-(2-fluorophenyl)-3-methyl-2-methylidene-5-phenyl-3,4-dihydro-1H-pyridine |
| PubChem CID | 159633874 |
| Molecular Formula | C19H18FN |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 6-(2-fluorophenyl)-3-methyl-2-methylidene-5-phenyl-3,4-dihydro-1H-pyridine |
| SMILES | C=C1NC(c2ccccc2F)=C(c2ccccc2)CC1C |
| InChI | InChI=1S/C19H18FN/c1-13-12-17(15-8-4-3-5-9-15)19(21-14(13)2)16-10-6-7-11-18(16)20/h3-11,13,21H,2,12H2,1H3 |
| InChIKey | ZFSRWBZCTMCGAE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-fluorophenyl)-3-methyl-2-methylidene-5-phenyl-3,4-dihydro-1H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-fluorophenyl)-3-methyl-2-methylidene-5-phenyl-3,4-dihydro-1H-pyridine?
The IUPAC name of 6-(2-fluorophenyl)-3-methyl-2-methylidene-5-phenyl-3,4-dihydro-1H-pyridine (CID 159633874) is 6-(2-fluorophenyl)-3-methyl-2-methylidene-5-phenyl-3,4-dihydro-1H-pyridine.
What is the SMILES notation for 6-(2-fluorophenyl)-3-methyl-2-methylidene-5-phenyl-3,4-dihydro-1H-pyridine?
The canonical SMILES for 6-(2-fluorophenyl)-3-methyl-2-methylidene-5-phenyl-3,4-dihydro-1H-pyridine is C=C1NC(c2ccccc2F)=C(c2ccccc2)CC1C.
What is the InChIKey of 6-(2-fluorophenyl)-3-methyl-2-methylidene-5-phenyl-3,4-dihydro-1H-pyridine?
The InChIKey is ZFSRWBZCTMCGAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18FN/c1-13-12-17(15-8-4-3-5-9-15)19(21-14(13)2)16-10-6-7-11-18(16)20/h3-11,13,21H,2,12H2,1H3.
What are the key properties of 6-(2-fluorophenyl)-3-methyl-2-methylidene-5-phenyl-3,4-dihydro-1H-pyridine?
6-(2-fluorophenyl)-3-methyl-2-methylidene-5-phenyl-3,4-dihydro-1H-pyridine has a molecular weight of 279.36 g/mol, XLogP of 4.84, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-fluorophenyl)-3-methyl-2-methylidene-5-phenyl-3,4-dihydro-1H-pyridine is sourced from PubChem (CID 159633874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).