About CID 15963515
CID 15963515 (PubChem CID 15963515) has the molecular formula C12H15BN
and a molecular weight of 184.07 g/mol.
Molecular Properties
| Compound Name | CID 15963515 |
| PubChem CID | 15963515 |
| Molecular Formula | C12H15BN |
| Molecular Weight | 184.07 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | — |
| SMILES | C=CC[C@H]1c2ccccc2CN1C.[B] |
| InChI | InChI=1S/C12H15N.B/c1-3-6-12-11-8-5-4-7-10(11)9-13(12)2;/h3-5,7-8,12H,1,6,9H2,2H3;/t12-;/m0./s1 |
| InChIKey | UMVZQDJLHPIWTM-YDALLXLXSA-N |
| XLogP | 2.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.07 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 15963515 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 15963515?
The IUPAC name of CID 15963515 (CID 15963515) is not available.
What is the SMILES notation for CID 15963515?
The canonical SMILES for CID 15963515 is C=CC[C@H]1c2ccccc2CN1C.[B].
What is the InChIKey of CID 15963515?
The InChIKey is UMVZQDJLHPIWTM-YDALLXLXSA-N. The full InChI is InChI=1S/C12H15N.B/c1-3-6-12-11-8-5-4-7-10(11)9-13(12)2;/h3-5,7-8,12H,1,6,9H2,2H3;/t12-;/m0./s1.
What are the key properties of CID 15963515?
CID 15963515 has a molecular weight of 184.07 g/mol, XLogP of 2.37, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 15963515 is sourced from PubChem (CID 15963515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).