About 4-bromo-2-ethyl-1-oxo-1,2-thiazol-3-one
4-bromo-2-ethyl-1-oxo-1,2-thiazol-3-one (PubChem CID 15963623) has the molecular formula C5H6BrNO2S
and a molecular weight of 224.08 g/mol. Its IUPAC name is 4-bromo-2-ethyl-1-oxo-1,2-thiazol-3-one.
Molecular Properties
| Compound Name | 4-bromo-2-ethyl-1-oxo-1,2-thiazol-3-one |
| PubChem CID | 15963623 |
| Molecular Formula | C5H6BrNO2S |
| Molecular Weight | 224.08 g/mol |
| Exact Mass | 222.93 |
| IUPAC Name | 4-bromo-2-ethyl-1-oxo-1,2-thiazol-3-one |
| SMILES | CCN1C(=O)C(Br)=CS1=O |
| InChI | InChI=1S/C5H6BrNO2S/c1-2-7-5(8)4(6)3-10(7)9/h3H,2H2,1H3 |
| InChIKey | QMQCJSRNZNOAGE-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.08 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-2-ethyl-1-oxo-1,2-thiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-ethyl-1-oxo-1,2-thiazol-3-one?
The IUPAC name of 4-bromo-2-ethyl-1-oxo-1,2-thiazol-3-one (CID 15963623) is 4-bromo-2-ethyl-1-oxo-1,2-thiazol-3-one.
What is the SMILES notation for 4-bromo-2-ethyl-1-oxo-1,2-thiazol-3-one?
The canonical SMILES for 4-bromo-2-ethyl-1-oxo-1,2-thiazol-3-one is CCN1C(=O)C(Br)=CS1=O.
What is the InChIKey of 4-bromo-2-ethyl-1-oxo-1,2-thiazol-3-one?
The InChIKey is QMQCJSRNZNOAGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6BrNO2S/c1-2-7-5(8)4(6)3-10(7)9/h3H,2H2,1H3.
What are the key properties of 4-bromo-2-ethyl-1-oxo-1,2-thiazol-3-one?
4-bromo-2-ethyl-1-oxo-1,2-thiazol-3-one has a molecular weight of 224.08 g/mol, XLogP of 0.75, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-ethyl-1-oxo-1,2-thiazol-3-one is sourced from PubChem (CID 15963623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).