C82H96N4 — CID 159636622
3-[2,6-bis(4-tert-butylcyclohexen-1-yl)phenyl]imidazo[1,2-f]phenanthridine;3-[2,6-bis(4-tert-butylcyclohexyl)phenyl]imidazo[1,2-f]phenanthridine (PubChem CID 159636622) has the molecular formula C82H96N4 and a molecular weight of 1137.70 g/mol. Its IUPAC name is 3-[2,6-bis(4-tert-butylcyclohexen-1-yl)phenyl]imidazo[1,2-f]phenanthridine;3-[2,6-bis(4-tert-butylcyclohexyl)phenyl]imidazo[1,2-f]phenanthridine.
| Compound Name | 3-[2,6-bis(4-tert-butylcyclohexen-1-yl)phenyl]imidazo[1,2-f]phenanthridine;3-[2,6-bis(4-tert-butylcyclohexyl)phenyl]imidazo[1,2-f]phenanthridine |
|---|---|
| PubChem CID | 159636622 |
| Molecular Formula | C82H96N4 |
| Molecular Weight | 1137.70 g/mol |
| Exact Mass | 1136.76 |
| IUPAC Name | 3-[2,6-bis(4-tert-butylcyclohexen-1-yl)phenyl]imidazo[1,2-f]phenanthridine;3-[2,6-bis(4-tert-butylcyclohexyl)phenyl]imidazo[1,2-f]phenanthridine |
| SMILES | CC(C)(C)C1CC=C(c2cccc(C3=CCC(C(C)(C)C)CC3)c2-c2cnc3c4ccccc4c4ccccc4n23)CC1.CC(C)(C)C1CCC(c2cccc(C3CCC(C(C)(C)C)CC3)c2-c2cnc3c4ccccc4c4ccccc4n23)CC1 |
| InChI | InChI=1S/C41H50N2.C41H46N2/c2*1-40(2,3)29-22-18-27(19-23-29)31-15-11-16-32(28-20-24-30(25-21-28)41(4,5)6)38(31)37-26-42-39-35-14-8-7-12-33(35)34-13-9-10-17-36(34)43(37)39/h7-17,26-30H,18-25H2,1-6H3;7-18,20,26,29-30H,19,21-25H2,1-6H3 |
| InChIKey | MPVDPXXIKHUQTO-UHFFFAOYSA-N |
| XLogP | 23.71 |
| TPSA | 34.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1137.70 |
| LogP ≤ 5 | 23.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|