C16H17N3O3 — CID 159637511
4-[5-amino-6,7,8-trideuterio-4-oxo-2-(trideuteriomethyl)quinazolin-3-yl]-4-methylcyclohexane-1,3-dione (PubChem CID 159637511) has the molecular formula C16H17N3O3 and a molecular weight of 305.37 g/mol. Its IUPAC name is 4-[5-amino-6,7,8-trideuterio-4-oxo-2-(trideuteriomethyl)quinazolin-3-yl]-4-methylcyclohexane-1,3-dione.
| Compound Name | 4-[5-amino-6,7,8-trideuterio-4-oxo-2-(trideuteriomethyl)quinazolin-3-yl]-4-methylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 159637511 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 4-[5-amino-6,7,8-trideuterio-4-oxo-2-(trideuteriomethyl)quinazolin-3-yl]-4-methylcyclohexane-1,3-dione |
| SMILES | [2H]c1c([2H])c(N)c2c(=O)n(C3(C)CCC(=O)CC3=O)c(C([2H])([2H])[2H])nc2c1[2H] |
| InChI | InChI=1S/C16H17N3O3/c1-9-18-12-5-3-4-11(17)14(12)15(22)19(9)16(2)7-6-10(20)8-13(16)21/h3-5H,6-8,17H2,1-2H3/i1D3,3D,4D,5D |
| InChIKey | SAPYPCBPDRODNS-YFNZQJCKSA-N |
| XLogP | 1.32 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|