C20H24N6O2 — CID 159638663
1-(3-methyl-1,2-oxazol-5-yl)ethanone;12-[(3S,4S)-4-methylpiperidin-3-yl]-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 159638663) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 1-(3-methyl-1,2-oxazol-5-yl)ethanone;12-[(3S,4S)-4-methylpiperidin-3-yl]-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 1-(3-methyl-1,2-oxazol-5-yl)ethanone;12-[(3S,4S)-4-methylpiperidin-3-yl]-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 159638663 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 1-(3-methyl-1,2-oxazol-5-yl)ethanone;12-[(3S,4S)-4-methylpiperidin-3-yl]-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | CC(=O)c1cc(C)no1.C[C@H]1CCNC[C@H]1c1ncc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C14H17N5.C6H7NO2/c1-9-2-4-15-8-11(9)14-18-7-10-6-17-13-12(19(10)14)3-5-16-13;1-4-3-6(5(2)8)9-7-4/h3,5-7,9,11,15-16H,2,4,8H2,1H3;3H,1-2H3/t9-,11+;/m0./s1 |
| InChIKey | MQBJBOQCHBWPLC-QLSWKGBWSA-N |
| XLogP | 3.11 |
| TPSA | 101.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |