About 2-(2-chlorobuta-1,3-dienyl)-3-ethyloxirane;9-oxabicyclo[6.1.0]non-4-ene
2-(2-chlorobuta-1,3-dienyl)-3-ethyloxirane;9-oxabicyclo[6.1.0]non-4-ene (PubChem CID 159638827) has the molecular formula C16H23ClO2
and a molecular weight of 282.81 g/mol. Its IUPAC name is 2-(2-chlorobuta-1,3-dienyl)-3-ethyloxirane;9-oxabicyclo[6.1.0]non-4-ene.
Molecular Properties
| Compound Name | 2-(2-chlorobuta-1,3-dienyl)-3-ethyloxirane;9-oxabicyclo[6.1.0]non-4-ene |
| PubChem CID | 159638827 |
| Molecular Formula | C16H23ClO2 |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-(2-chlorobuta-1,3-dienyl)-3-ethyloxirane;9-oxabicyclo[6.1.0]non-4-ene |
| SMILES | C1=CCCC2OC2CC1.C=CC(Cl)=CC1OC1CC |
| InChI | InChI=1S/C8H11ClO.C8H12O/c1-3-6(9)5-8-7(4-2)10-8;1-2-4-6-8-7(9-8)5-3-1/h3,5,7-8H,1,4H2,2H3;1-2,7-8H,3-6H2 |
| InChIKey | MQBVXZDMWCBKHD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chlorobuta-1,3-dienyl)-3-ethyloxirane;9-oxabicyclo[6.1.0]non-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chlorobuta-1,3-dienyl)-3-ethyloxirane;9-oxabicyclo[6.1.0]non-4-ene?
The IUPAC name of 2-(2-chlorobuta-1,3-dienyl)-3-ethyloxirane;9-oxabicyclo[6.1.0]non-4-ene (CID 159638827) is 2-(2-chlorobuta-1,3-dienyl)-3-ethyloxirane;9-oxabicyclo[6.1.0]non-4-ene.
What is the SMILES notation for 2-(2-chlorobuta-1,3-dienyl)-3-ethyloxirane;9-oxabicyclo[6.1.0]non-4-ene?
The canonical SMILES for 2-(2-chlorobuta-1,3-dienyl)-3-ethyloxirane;9-oxabicyclo[6.1.0]non-4-ene is C1=CCCC2OC2CC1.C=CC(Cl)=CC1OC1CC.
What is the InChIKey of 2-(2-chlorobuta-1,3-dienyl)-3-ethyloxirane;9-oxabicyclo[6.1.0]non-4-ene?
The InChIKey is MQBVXZDMWCBKHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClO.C8H12O/c1-3-6(9)5-8-7(4-2)10-8;1-2-4-6-8-7(9-8)5-3-1/h3,5,7-8H,1,4H2,2H3;1-2,7-8H,3-6H2.
What are the key properties of 2-(2-chlorobuta-1,3-dienyl)-3-ethyloxirane;9-oxabicyclo[6.1.0]non-4-ene?
2-(2-chlorobuta-1,3-dienyl)-3-ethyloxirane;9-oxabicyclo[6.1.0]non-4-ene has a molecular weight of 282.81 g/mol, XLogP of 4.36, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chlorobuta-1,3-dienyl)-3-ethyloxirane;9-oxabicyclo[6.1.0]non-4-ene is sourced from PubChem (CID 159638827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).