About 5-ethyl-2-phenylpyridine;iridium(3+);tris(trifluoromethanesulfonate)
5-ethyl-2-phenylpyridine;iridium(3+);tris(trifluoromethanesulfonate) (PubChem CID 159639576) has the molecular formula C16H13F9IrNO9S3
and a molecular weight of 822.68 g/mol. Its IUPAC name is 5-ethyl-2-phenylpyridine;iridium(3+);tris(trifluoromethanesulfonate).
Molecular Properties
| Compound Name | 5-ethyl-2-phenylpyridine;iridium(3+);tris(trifluoromethanesulfonate) |
| PubChem CID | 159639576 |
| Molecular Formula | C16H13F9IrNO9S3 |
| Molecular Weight | 822.68 g/mol |
| Exact Mass | 822.92 |
| IUPAC Name | 5-ethyl-2-phenylpyridine;iridium(3+);tris(trifluoromethanesulfonate) |
| SMILES | CCc1ccc(-c2ccccc2)nc1.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.[Ir+3] |
| InChI | InChI=1S/C13H13N.3CHF3O3S.Ir/c1-2-11-8-9-13(14-10-11)12-6-4-3-5-7-12;3*2-1(3,4)8(5,6)7;/h3-10H,2H2,1H3;3*(H,5,6,7);/q;;;;+3/p-3 |
| InChIKey | MQEHRFGODKUUAR-UHFFFAOYSA-K |
| XLogP | 3.46 |
| TPSA | 184.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 822.68 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-2-phenylpyridine;iridium(3+);tris(trifluoromethanesulfonate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-phenylpyridine;iridium(3+);tris(trifluoromethanesulfonate)?
The IUPAC name of 5-ethyl-2-phenylpyridine;iridium(3+);tris(trifluoromethanesulfonate) (CID 159639576) is 5-ethyl-2-phenylpyridine;iridium(3+);tris(trifluoromethanesulfonate).
What is the SMILES notation for 5-ethyl-2-phenylpyridine;iridium(3+);tris(trifluoromethanesulfonate)?
The canonical SMILES for 5-ethyl-2-phenylpyridine;iridium(3+);tris(trifluoromethanesulfonate) is CCc1ccc(-c2ccccc2)nc1.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.[Ir+3].
What is the InChIKey of 5-ethyl-2-phenylpyridine;iridium(3+);tris(trifluoromethanesulfonate)?
The InChIKey is MQEHRFGODKUUAR-UHFFFAOYSA-K. The full InChI is InChI=1S/C13H13N.3CHF3O3S.Ir/c1-2-11-8-9-13(14-10-11)12-6-4-3-5-7-12;3*2-1(3,4)8(5,6)7;/h3-10H,2H2,1H3;3*(H,5,6,7);/q;;;;+3/p-3.
What are the key properties of 5-ethyl-2-phenylpyridine;iridium(3+);tris(trifluoromethanesulfonate)?
5-ethyl-2-phenylpyridine;iridium(3+);tris(trifluoromethanesulfonate) has a molecular weight of 822.68 g/mol, XLogP of 3.46, 2 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-phenylpyridine;iridium(3+);tris(trifluoromethanesulfonate) is sourced from PubChem (CID 159639576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).