C19H28N2O6S — CID 159640251
(2S)-2-tert-butyl-3-[(4-methylphenyl)sulfonylamino]-4-morpholin-4-yl-4-oxobutanoic acid (PubChem CID 159640251) has the molecular formula C19H28N2O6S and a molecular weight of 412.51 g/mol. Its IUPAC name is (2S)-2-tert-butyl-3-[(4-methylphenyl)sulfonylamino]-4-morpholin-4-yl-4-oxobutanoic acid.
| Compound Name | (2S)-2-tert-butyl-3-[(4-methylphenyl)sulfonylamino]-4-morpholin-4-yl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 159640251 |
| Molecular Formula | C19H28N2O6S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (2S)-2-tert-butyl-3-[(4-methylphenyl)sulfonylamino]-4-morpholin-4-yl-4-oxobutanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)NC(C(=O)N2CCOCC2)[C@@H](C(=O)O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H28N2O6S/c1-13-5-7-14(8-6-13)28(25,26)20-16(15(18(23)24)19(2,3)4)17(22)21-9-11-27-12-10-21/h5-8,15-16,20H,9-12H2,1-4H3,(H,23,24)/t15-,16?/m0/s1 |
| InChIKey | HSRXUMFVRRXHEK-VYRBHSGPSA-N |
| XLogP | 1.25 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |