About carbanide;(2-phenylcyclohex-2-en-1-yl)methanol;yttrium
carbanide;(2-phenylcyclohex-2-en-1-yl)methanol;yttrium (PubChem CID 159640672) has the molecular formula C14H19OY-
and a molecular weight of 292.21 g/mol. Its IUPAC name is carbanide;(2-phenylcyclohex-2-en-1-yl)methanol;yttrium.
Molecular Properties
| Compound Name | carbanide;(2-phenylcyclohex-2-en-1-yl)methanol;yttrium |
| PubChem CID | 159640672 |
| Molecular Formula | C14H19OY- |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | carbanide;(2-phenylcyclohex-2-en-1-yl)methanol;yttrium |
| SMILES | OCC1CCCC=C1c1ccccc1.[CH3-].[Y] |
| InChI | InChI=1S/C13H16O.CH3.Y/c14-10-12-8-4-5-9-13(12)11-6-2-1-3-7-11;;/h1-3,6-7,9,12,14H,4-5,8,10H2;1H3;/q;-1; |
| InChIKey | UIAWDXMIQDVGKN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;(2-phenylcyclohex-2-en-1-yl)methanol;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;(2-phenylcyclohex-2-en-1-yl)methanol;yttrium?
The IUPAC name of carbanide;(2-phenylcyclohex-2-en-1-yl)methanol;yttrium (CID 159640672) is carbanide;(2-phenylcyclohex-2-en-1-yl)methanol;yttrium.
What is the SMILES notation for carbanide;(2-phenylcyclohex-2-en-1-yl)methanol;yttrium?
The canonical SMILES for carbanide;(2-phenylcyclohex-2-en-1-yl)methanol;yttrium is OCC1CCCC=C1c1ccccc1.[CH3-].[Y].
What is the InChIKey of carbanide;(2-phenylcyclohex-2-en-1-yl)methanol;yttrium?
The InChIKey is UIAWDXMIQDVGKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O.CH3.Y/c14-10-12-8-4-5-9-13(12)11-6-2-1-3-7-11;;/h1-3,6-7,9,12,14H,4-5,8,10H2;1H3;/q;-1;.
What are the key properties of carbanide;(2-phenylcyclohex-2-en-1-yl)methanol;yttrium?
carbanide;(2-phenylcyclohex-2-en-1-yl)methanol;yttrium has a molecular weight of 292.21 g/mol, XLogP of 3.31, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;(2-phenylcyclohex-2-en-1-yl)methanol;yttrium is sourced from PubChem (CID 159640672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).