C23H35N3O — CID 159642761
1-[2-amino-4-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]-2,4-dimethylpiperidin-1-yl]ethanone (PubChem CID 159642761) has the molecular formula C23H35N3O and a molecular weight of 369.55 g/mol. Its IUPAC name is 1-[2-amino-4-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]-2,4-dimethylpiperidin-1-yl]ethanone.
| Compound Name | 1-[2-amino-4-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]-2,4-dimethylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 159642761 |
| Molecular Formula | C23H35N3O |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.28 |
| IUPAC Name | 1-[2-amino-4-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]-2,4-dimethylpiperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(C)(c2ccc(N)c(C3=CCC(C)(C)CC3)c2)CC1(C)N |
| InChI | InChI=1S/C23H35N3O/c1-16(27)26-13-12-22(4,15-23(26,5)25)18-6-7-20(24)19(14-18)17-8-10-21(2,3)11-9-17/h6-8,14H,9-13,15,24-25H2,1-5H3 |
| InChIKey | ARYZOZRFSPATIP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|