About 4-(2-hydroxyethylsulfanyl)benzaldehyde;4-iodobenzaldehyde
4-(2-hydroxyethylsulfanyl)benzaldehyde;4-iodobenzaldehyde (PubChem CID 159643020) has the molecular formula C16H15IO3S
and a molecular weight of 414.26 g/mol. Its IUPAC name is 4-(2-hydroxyethylsulfanyl)benzaldehyde;4-iodobenzaldehyde.
Molecular Properties
| Compound Name | 4-(2-hydroxyethylsulfanyl)benzaldehyde;4-iodobenzaldehyde |
| PubChem CID | 159643020 |
| Molecular Formula | C16H15IO3S |
| Molecular Weight | 414.26 g/mol |
| Exact Mass | 413.98 |
| IUPAC Name | 4-(2-hydroxyethylsulfanyl)benzaldehyde;4-iodobenzaldehyde |
| SMILES | O=Cc1ccc(I)cc1.O=Cc1ccc(SCCO)cc1 |
| InChI | InChI=1S/C9H10O2S.C7H5IO/c10-5-6-12-9-3-1-8(7-11)2-4-9;8-7-3-1-6(5-9)2-4-7/h1-4,7,10H,5-6H2;1-5H |
| InChIKey | MQPDCVNYZIGNLZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.26 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-hydroxyethylsulfanyl)benzaldehyde;4-iodobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-hydroxyethylsulfanyl)benzaldehyde;4-iodobenzaldehyde?
The IUPAC name of 4-(2-hydroxyethylsulfanyl)benzaldehyde;4-iodobenzaldehyde (CID 159643020) is 4-(2-hydroxyethylsulfanyl)benzaldehyde;4-iodobenzaldehyde.
What is the SMILES notation for 4-(2-hydroxyethylsulfanyl)benzaldehyde;4-iodobenzaldehyde?
The canonical SMILES for 4-(2-hydroxyethylsulfanyl)benzaldehyde;4-iodobenzaldehyde is O=Cc1ccc(I)cc1.O=Cc1ccc(SCCO)cc1.
What is the InChIKey of 4-(2-hydroxyethylsulfanyl)benzaldehyde;4-iodobenzaldehyde?
The InChIKey is MQPDCVNYZIGNLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2S.C7H5IO/c10-5-6-12-9-3-1-8(7-11)2-4-9;8-7-3-1-6(5-9)2-4-7/h1-4,7,10H,5-6H2;1-5H.
What are the key properties of 4-(2-hydroxyethylsulfanyl)benzaldehyde;4-iodobenzaldehyde?
4-(2-hydroxyethylsulfanyl)benzaldehyde;4-iodobenzaldehyde has a molecular weight of 414.26 g/mol, XLogP of 3.69, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-hydroxyethylsulfanyl)benzaldehyde;4-iodobenzaldehyde is sourced from PubChem (CID 159643020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).