C13H17F3N8S2 — CID 159644018
1-ethyl-3-[[1-pyrimidin-2-yl-2-(2,2,2-trifluoroethylcarbamothioylhydrazinylidene)propylidene]amino]thiourea (PubChem CID 159644018) has the molecular formula C13H17F3N8S2 and a molecular weight of 406.46 g/mol. Its IUPAC name is 1-ethyl-3-[[1-pyrimidin-2-yl-2-(2,2,2-trifluoroethylcarbamothioylhydrazinylidene)propylidene]amino]thiourea.
| Compound Name | 1-ethyl-3-[[1-pyrimidin-2-yl-2-(2,2,2-trifluoroethylcarbamothioylhydrazinylidene)propylidene]amino]thiourea |
|---|---|
| PubChem CID | 159644018 |
| Molecular Formula | C13H17F3N8S2 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 1-ethyl-3-[[1-pyrimidin-2-yl-2-(2,2,2-trifluoroethylcarbamothioylhydrazinylidene)propylidene]amino]thiourea |
| SMILES | CCNC(=S)NN=C(C(C)=NNC(=S)NCC(F)(F)F)c1ncccn1 |
| InChI | InChI=1S/C13H17F3N8S2/c1-3-17-11(25)24-22-9(10-18-5-4-6-19-10)8(2)21-23-12(26)20-7-13(14,15)16/h4-6H,3,7H2,1-2H3,(H2,17,24,25)(H2,20,23,26) |
| InChIKey | JMRRXKFMAKDJLX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 98.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|