C34H33F6NO7S4 — CID 159646331
[3-(4-cyclohexylphenoxy)sulfonyl-1,1,2,2,3,3-hexafluoropropyl]sulfonyl-methylsulfonylazanide;triphenylsulfanium (PubChem CID 159646331) has the molecular formula C34H33F6NO7S4 and a molecular weight of 809.89 g/mol. Its IUPAC name is [3-(4-cyclohexylphenoxy)sulfonyl-1,1,2,2,3,3-hexafluoropropyl]sulfonyl-methylsulfonylazanide;triphenylsulfanium.
| Compound Name | [3-(4-cyclohexylphenoxy)sulfonyl-1,1,2,2,3,3-hexafluoropropyl]sulfonyl-methylsulfonylazanide;triphenylsulfanium |
|---|---|
| PubChem CID | 159646331 |
| Molecular Formula | C34H33F6NO7S4 |
| Molecular Weight | 809.89 g/mol |
| Exact Mass | 809.10 |
| IUPAC Name | [3-(4-cyclohexylphenoxy)sulfonyl-1,1,2,2,3,3-hexafluoropropyl]sulfonyl-methylsulfonylazanide;triphenylsulfanium |
| SMILES | CS(=O)(=O)[N-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)Oc1ccc(C2CCCCC2)cc1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C16H18F6NO7S3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-31(24,25)23-32(26,27)15(19,20)14(17,18)16(21,22)33(28,29)30-13-9-7-12(8-10-13)11-5-3-2-4-6-11/h1-15H;7-11H,2-6H2,1H3/q+1;-1 |
| InChIKey | MQZTYJYVMDFLKM-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 125.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.89 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|