C27H33F2N3O4S — CID 159646879
2-(2,5-difluorophenyl)benzoic acid;(2S)-N-[(2-ethoxy-4-ethyl-1H-imidazol-5-yl)methyl]-4-methyl-2-sulfanylpentanamide (PubChem CID 159646879) has the molecular formula C27H33F2N3O4S and a molecular weight of 533.64 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)benzoic acid;(2S)-N-[(2-ethoxy-4-ethyl-1H-imidazol-5-yl)methyl]-4-methyl-2-sulfanylpentanamide.
| Compound Name | 2-(2,5-difluorophenyl)benzoic acid;(2S)-N-[(2-ethoxy-4-ethyl-1H-imidazol-5-yl)methyl]-4-methyl-2-sulfanylpentanamide |
|---|---|
| PubChem CID | 159646879 |
| Molecular Formula | C27H33F2N3O4S |
| Molecular Weight | 533.64 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | 2-(2,5-difluorophenyl)benzoic acid;(2S)-N-[(2-ethoxy-4-ethyl-1H-imidazol-5-yl)methyl]-4-methyl-2-sulfanylpentanamide |
| SMILES | CCOc1nc(CC)c(CNC(=O)[C@@H](S)CC(C)C)[nH]1.O=C(O)c1ccccc1-c1cc(F)ccc1F |
| InChI | InChI=1S/C14H25N3O2S.C13H8F2O2/c1-5-10-11(17-14(16-10)19-6-2)8-15-13(18)12(20)7-9(3)4;14-8-5-6-12(15)11(7-8)9-3-1-2-4-10(9)13(16)17/h9,12,20H,5-8H2,1-4H3,(H,15,18)(H,16,17);1-7H,(H,16,17)/t12-;/m0./s1 |
| InChIKey | MRBJXTHCKCNAEM-YDALLXLXSA-N |
| XLogP | 5.66 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.64 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|