About tert-butyl 4-(2-methoxy-2-oxoethyl)piperazine-1-carboxylate;methyl 2-piperazin-1-ylacetate;hydrochloride
tert-butyl 4-(2-methoxy-2-oxoethyl)piperazine-1-carboxylate;methyl 2-piperazin-1-ylacetate;hydrochloride (PubChem CID 159647083) has the molecular formula C19H37ClN4O6
and a molecular weight of 452.98 g/mol. Its IUPAC name is tert-butyl 4-(2-methoxy-2-oxoethyl)piperazine-1-carboxylate;methyl 2-piperazin-1-ylacetate;hydrochloride.
Molecular Properties
| Compound Name | tert-butyl 4-(2-methoxy-2-oxoethyl)piperazine-1-carboxylate;methyl 2-piperazin-1-ylacetate;hydrochloride |
| PubChem CID | 159647083 |
| Molecular Formula | C19H37ClN4O6 |
| Molecular Weight | 452.98 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | tert-butyl 4-(2-methoxy-2-oxoethyl)piperazine-1-carboxylate;methyl 2-piperazin-1-ylacetate;hydrochloride |
| SMILES | COC(=O)CN1CCN(C(=O)OC(C)(C)C)CC1.COC(=O)CN1CCNCC1.Cl |
| InChI | InChI=1S/C12H22N2O4.C7H14N2O2.ClH/c1-12(2,3)18-11(16)14-7-5-13(6-8-14)9-10(15)17-4;1-11-7(10)6-9-4-2-8-3-5-9;/h5-9H2,1-4H3;8H,2-6H2,1H3;1H |
| InChIKey | SXQUOJXKNSMMJP-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.98 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-(2-methoxy-2-oxoethyl)piperazine-1-carboxylate;methyl 2-piperazin-1-ylacetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(2-methoxy-2-oxoethyl)piperazine-1-carboxylate;methyl 2-piperazin-1-ylacetate;hydrochloride?
The IUPAC name of tert-butyl 4-(2-methoxy-2-oxoethyl)piperazine-1-carboxylate;methyl 2-piperazin-1-ylacetate;hydrochloride (CID 159647083) is tert-butyl 4-(2-methoxy-2-oxoethyl)piperazine-1-carboxylate;methyl 2-piperazin-1-ylacetate;hydrochloride.
What is the SMILES notation for tert-butyl 4-(2-methoxy-2-oxoethyl)piperazine-1-carboxylate;methyl 2-piperazin-1-ylacetate;hydrochloride?
The canonical SMILES for tert-butyl 4-(2-methoxy-2-oxoethyl)piperazine-1-carboxylate;methyl 2-piperazin-1-ylacetate;hydrochloride is COC(=O)CN1CCN(C(=O)OC(C)(C)C)CC1.COC(=O)CN1CCNCC1.Cl.
What is the InChIKey of tert-butyl 4-(2-methoxy-2-oxoethyl)piperazine-1-carboxylate;methyl 2-piperazin-1-ylacetate;hydrochloride?
The InChIKey is SXQUOJXKNSMMJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O4.C7H14N2O2.ClH/c1-12(2,3)18-11(16)14-7-5-13(6-8-14)9-10(15)17-4;1-11-7(10)6-9-4-2-8-3-5-9;/h5-9H2,1-4H3;8H,2-6H2,1H3;1H.
What are the key properties of tert-butyl 4-(2-methoxy-2-oxoethyl)piperazine-1-carboxylate;methyl 2-piperazin-1-ylacetate;hydrochloride?
tert-butyl 4-(2-methoxy-2-oxoethyl)piperazine-1-carboxylate;methyl 2-piperazin-1-ylacetate;hydrochloride has a molecular weight of 452.98 g/mol, XLogP of 0.20, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(2-methoxy-2-oxoethyl)piperazine-1-carboxylate;methyl 2-piperazin-1-ylacetate;hydrochloride is sourced from PubChem (CID 159647083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).