C22H30ClN3O2 — CID 159647260
N-[[2-chloro-5-(3-methoxypropyl)phenyl]methyl]-N-cyclopropyl-1,2-diazabicyclo[3.3.1]non-6-ene-6-carboxamide (PubChem CID 159647260) has the molecular formula C22H30ClN3O2 and a molecular weight of 403.95 g/mol. Its IUPAC name is N-[[2-chloro-5-(3-methoxypropyl)phenyl]methyl]-N-cyclopropyl-1,2-diazabicyclo[3.3.1]non-6-ene-6-carboxamide.
| Compound Name | N-[[2-chloro-5-(3-methoxypropyl)phenyl]methyl]-N-cyclopropyl-1,2-diazabicyclo[3.3.1]non-6-ene-6-carboxamide |
|---|---|
| PubChem CID | 159647260 |
| Molecular Formula | C22H30ClN3O2 |
| Molecular Weight | 403.95 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | N-[[2-chloro-5-(3-methoxypropyl)phenyl]methyl]-N-cyclopropyl-1,2-diazabicyclo[3.3.1]non-6-ene-6-carboxamide |
| SMILES | COCCCc1ccc(Cl)c(CN(C(=O)C2=CCN3CC2CCN3)C2CC2)c1 |
| InChI | InChI=1S/C22H30ClN3O2/c1-28-12-2-3-16-4-7-21(23)18(13-16)15-26(19-5-6-19)22(27)20-9-11-25-14-17(20)8-10-24-25/h4,7,9,13,17,19,24H,2-3,5-6,8,10-12,14-15H2,1H3 |
| InChIKey | MRCPDKVAIHPZIZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.95 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|