C14H20N2S — CID 159647449
5,7-ditert-butyl-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 159647449) has the molecular formula C14H20N2S and a molecular weight of 248.39 g/mol. Its IUPAC name is 5,7-ditert-butyl-[1,3]thiazolo[5,4-b]pyridine.
| Compound Name | 5,7-ditert-butyl-[1,3]thiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 159647449 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 5,7-ditert-butyl-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2ncsc2n1 |
| InChI | InChI=1S/C14H20N2S/c1-13(2,3)9-7-10(14(4,5)6)16-12-11(9)15-8-17-12/h7-8H,1-6H3 |
| InChIKey | IUNHJDILNKGTLN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |