About CID 15964822
CID 15964822 (PubChem CID 15964822) has the molecular formula C28H39Si
and a molecular weight of 403.71 g/mol.
Molecular Properties
| Compound Name | CID 15964822 |
| PubChem CID | 15964822 |
| Molecular Formula | C28H39Si |
| Molecular Weight | 403.71 g/mol |
| Exact Mass | 403.28 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si]1C2=C(C3=C(C4=C1C1CCC4CC1)C1CCC3CC1)C1CCC2CC1 |
| InChI | InChI=1S/C28H39Si/c1-28(2,3)29-26-20-12-8-18(9-13-20)24(26)22-16-4-5-17(7-6-16)23(22)25-19-10-14-21(15-11-19)27(25)29/h16-21H,4-15H2,1-3H3 |
| InChIKey | HNLYTFVAYLMGET-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.71 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 15964822 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 15964822?
The IUPAC name of CID 15964822 (CID 15964822) is not available.
What is the SMILES notation for CID 15964822?
The canonical SMILES for CID 15964822 is CC(C)(C)[Si]1C2=C(C3=C(C4=C1C1CCC4CC1)C1CCC3CC1)C1CCC2CC1.
What is the InChIKey of CID 15964822?
The InChIKey is HNLYTFVAYLMGET-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H39Si/c1-28(2,3)29-26-20-12-8-18(9-13-20)24(26)22-16-4-5-17(7-6-16)23(22)25-19-10-14-21(15-11-19)27(25)29/h16-21H,4-15H2,1-3H3.
What are the key properties of CID 15964822?
CID 15964822 has a molecular weight of 403.71 g/mol, XLogP of 7.72, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 15964822 is sourced from PubChem (CID 15964822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).