C24H30Cl2Si — CID 15964823
15,15-dichloro-15-silaheptacyclo[15.2.2.24,7.210,13.02,16.03,8.09,14]pentacosa-2(16),3(8),9(14)-triene (PubChem CID 15964823) has the molecular formula C24H30Cl2Si and a molecular weight of 417.50 g/mol. Its IUPAC name is 15,15-dichloro-15-silaheptacyclo[15.2.2.24,7.210,13.02,16.03,8.09,14]pentacosa-2(16),3(8),9(14)-triene.
| Compound Name | 15,15-dichloro-15-silaheptacyclo[15.2.2.24,7.210,13.02,16.03,8.09,14]pentacosa-2(16),3(8),9(14)-triene |
|---|---|
| PubChem CID | 15964823 |
| Molecular Formula | C24H30Cl2Si |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 15,15-dichloro-15-silaheptacyclo[15.2.2.24,7.210,13.02,16.03,8.09,14]pentacosa-2(16),3(8),9(14)-triene |
| SMILES | Cl[Si]1(Cl)C2=C(C3=C(C4=C1C1CCC4CC1)C1CCC3CC1)C1CCC2CC1 |
| InChI | InChI=1S/C24H30Cl2Si/c25-27(26)23-17-9-5-15(6-10-17)21(23)19-13-1-2-14(4-3-13)20(19)22-16-7-11-18(12-8-16)24(22)27/h13-18H,1-12H2 |
| InChIKey | JWMNIJKNCLSFIK-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|