C19H38O5Si — CID 159648775
(3S)-3-[(6S,7S,8aR)-2,2-ditert-butyl-7-methoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl]butan-1-ol (PubChem CID 159648775) has the molecular formula C19H38O5Si and a molecular weight of 374.59 g/mol. Its IUPAC name is (3S)-3-[(6S,7S,8aR)-2,2-ditert-butyl-7-methoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl]butan-1-ol.
| Compound Name | (3S)-3-[(6S,7S,8aR)-2,2-ditert-butyl-7-methoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl]butan-1-ol |
|---|---|
| PubChem CID | 159648775 |
| Molecular Formula | C19H38O5Si |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | (3S)-3-[(6S,7S,8aR)-2,2-ditert-butyl-7-methoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl]butan-1-ol |
| SMILES | CO[C@H]1C[C@H]2O[Si](C(C)(C)C)(C(C)(C)C)OCC2O[C@H]1[C@@H](C)CCO |
| InChI | InChI=1S/C19H38O5Si/c1-13(9-10-20)17-15(21-8)11-14-16(23-17)12-22-25(24-14,18(2,3)4)19(5,6)7/h13-17,20H,9-12H2,1-8H3/t13-,14+,15-,16?,17-/m0/s1 |
| InChIKey | MRHKFYBHCFONSN-HTYVYXPBSA-N |
| XLogP | 3.64 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|