C6H18N2O5 — CID 159649521
3-aminopropane-1,2-diol;1-aminopropane-1,2,3-triol (PubChem CID 159649521) has the molecular formula C6H18N2O5 and a molecular weight of 198.22 g/mol. Its IUPAC name is 3-aminopropane-1,2-diol;1-aminopropane-1,2,3-triol.
| Compound Name | 3-aminopropane-1,2-diol;1-aminopropane-1,2,3-triol |
|---|---|
| PubChem CID | 159649521 |
| Molecular Formula | C6H18N2O5 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 3-aminopropane-1,2-diol;1-aminopropane-1,2,3-triol |
| SMILES | NC(O)C(O)CO.NCC(O)CO |
| InChI | InChI=1S/C3H9NO3.C3H9NO2/c4-3(7)2(6)1-5;4-1-3(6)2-5/h2-3,5-7H,1,4H2;3,5-6H,1-2,4H2 |
| InChIKey | MRJNWRZZFGDDBA-UHFFFAOYSA-N |
| XLogP | -4.09 |
| TPSA | 153.19 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -4.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|