About CID 159649825
CID 159649825 (PubChem CID 159649825) has the molecular formula C38H44B3BrCl2F2N8O4
and a molecular weight of 898.06 g/mol.
Molecular Properties
| Compound Name | CID 159649825 |
| PubChem CID | 159649825 |
| Molecular Formula | C38H44B3BrCl2F2N8O4 |
| Molecular Weight | 898.06 g/mol |
| Exact Mass | 896.23 |
| IUPAC Name | — |
| SMILES | CC1(C)OB(c2cnc(N)c(F)c2)OC1(C)C.Nc1ncc(-c2cc(Cl)cc(N3CCN([B]C=O)CC3)c2)cc1F.O=C[B]N1CCN(c2cc(Cl)cc(Br)c2)CC1 |
| InChI | InChI=1S/C16H16BClFN4O.C11H12BBrClN2O.C11H16BFN2O2/c18-13-5-11(12-7-15(19)16(20)21-9-12)6-14(8-13)22-1-3-23(4-2-22)17-10-24;13-9-5-10(14)7-11(6-9)15-1-3-16(4-2-15)12-8-17;1-10(2)11(3,4)17-12(16-10)7-5-8(13)9(14)15-6-7/h5-10H,1-4H2,(H2,20,21);5-8H,1-4H2;5-6H,1-4H3,(H2,14,15) |
| InChIKey | YFBWCHVHGVOFJN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 143.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 898.06 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 159649825 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159649825?
The IUPAC name of CID 159649825 (CID 159649825) is not available.
What is the SMILES notation for CID 159649825?
The canonical SMILES for CID 159649825 is CC1(C)OB(c2cnc(N)c(F)c2)OC1(C)C.Nc1ncc(-c2cc(Cl)cc(N3CCN([B]C=O)CC3)c2)cc1F.O=C[B]N1CCN(c2cc(Cl)cc(Br)c2)CC1.
What is the InChIKey of CID 159649825?
The InChIKey is YFBWCHVHGVOFJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16BClFN4O.C11H12BBrClN2O.C11H16BFN2O2/c18-13-5-11(12-7-15(19)16(20)21-9-12)6-14(8-13)22-1-3-23(4-2-22)17-10-24;13-9-5-10(14)7-11(6-9)15-1-3-16(4-2-15)12-8-17;1-10(2)11(3,4)17-12(16-10)7-5-8(13)9(14)15-6-7/h5-10H,1-4H2,(H2,20,21);5-8H,1-4H2;5-6H,1-4H3,(H2,14,15).
What are the key properties of CID 159649825?
CID 159649825 has a molecular weight of 898.06 g/mol, XLogP of 5.19, 8 rotatable bonds, 2 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159649825 is sourced from PubChem (CID 159649825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).