C18H36N4O3 — CID 159651574
2,2-dimethylpropane;2,2-dimethyl-N-[2-[2-[2-(triazol-1-yl)ethoxy]ethoxy]ethyl]propanamide (PubChem CID 159651574) has the molecular formula C18H36N4O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is 2,2-dimethylpropane;2,2-dimethyl-N-[2-[2-[2-(triazol-1-yl)ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | 2,2-dimethylpropane;2,2-dimethyl-N-[2-[2-[2-(triazol-1-yl)ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 159651574 |
| Molecular Formula | C18H36N4O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.28 |
| IUPAC Name | 2,2-dimethylpropane;2,2-dimethyl-N-[2-[2-[2-(triazol-1-yl)ethoxy]ethoxy]ethyl]propanamide |
| SMILES | CC(C)(C)C.CC(C)(C)C(=O)NCCOCCOCCn1ccnn1 |
| InChI | InChI=1S/C13H24N4O3.C5H12/c1-13(2,3)12(18)14-5-8-19-10-11-20-9-7-17-6-4-15-16-17;1-5(2,3)4/h4,6H,5,7-11H2,1-3H3,(H,14,18);1-4H3 |
| InChIKey | MRQDMRZCTFECMV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|