C20H20BBrN4O2 — CID 159652019
1-(4-bromo-3-methylphenyl)pyrazole;(2-methyl-4-pyrazol-1-ylphenyl)boronic acid (PubChem CID 159652019) has the molecular formula C20H20BBrN4O2 and a molecular weight of 439.12 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)pyrazole;(2-methyl-4-pyrazol-1-ylphenyl)boronic acid.
| Compound Name | 1-(4-bromo-3-methylphenyl)pyrazole;(2-methyl-4-pyrazol-1-ylphenyl)boronic acid |
|---|---|
| PubChem CID | 159652019 |
| Molecular Formula | C20H20BBrN4O2 |
| Molecular Weight | 439.12 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)pyrazole;(2-methyl-4-pyrazol-1-ylphenyl)boronic acid |
| SMILES | Cc1cc(-n2cccn2)ccc1B(O)O.Cc1cc(-n2cccn2)ccc1Br |
| InChI | InChI=1S/C10H11BN2O2.C10H9BrN2/c1-8-7-9(13-6-2-5-12-13)3-4-10(8)11(14)15;1-8-7-9(3-4-10(8)11)13-6-2-5-12-13/h2-7,14-15H,1H3;2-7H,1H3 |
| InChIKey | MRRPDLPLXSETLG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.12 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|