About ethanolate;4-ethyl-1H-inden-1-ide;titanium(4+)
ethanolate;4-ethyl-1H-inden-1-ide;titanium(4+) (PubChem CID 159652722) has the molecular formula C17H26O3Ti
and a molecular weight of 326.26 g/mol. Its IUPAC name is ethanolate;4-ethyl-1H-inden-1-ide;titanium(4+).
Molecular Properties
| Compound Name | ethanolate;4-ethyl-1H-inden-1-ide;titanium(4+) |
| PubChem CID | 159652722 |
| Molecular Formula | C17H26O3Ti |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | ethanolate;4-ethyl-1H-inden-1-ide;titanium(4+) |
| SMILES | CC[O-].CC[O-].CC[O-].CCc1cccc2[cH-]ccc12.[Ti+4] |
| InChI | InChI=1S/C11H11.3C2H5O.Ti/c1-2-9-5-3-6-10-7-4-8-11(9)10;3*1-2-3;/h3-8H,2H2,1H3;3*2H2,1H3;/q4*-1;+4 |
| InChIKey | AFBBMSCFLAGOSC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethanolate;4-ethyl-1H-inden-1-ide;titanium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanolate;4-ethyl-1H-inden-1-ide;titanium(4+)?
The IUPAC name of ethanolate;4-ethyl-1H-inden-1-ide;titanium(4+) (CID 159652722) is ethanolate;4-ethyl-1H-inden-1-ide;titanium(4+).
What is the SMILES notation for ethanolate;4-ethyl-1H-inden-1-ide;titanium(4+)?
The canonical SMILES for ethanolate;4-ethyl-1H-inden-1-ide;titanium(4+) is CC[O-].CC[O-].CC[O-].CCc1cccc2[cH-]ccc12.[Ti+4].
What is the InChIKey of ethanolate;4-ethyl-1H-inden-1-ide;titanium(4+)?
The InChIKey is AFBBMSCFLAGOSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11.3C2H5O.Ti/c1-2-9-5-3-6-10-7-4-8-11(9)10;3*1-2-3;/h3-8H,2H2,1H3;3*2H2,1H3;/q4*-1;+4.
What are the key properties of ethanolate;4-ethyl-1H-inden-1-ide;titanium(4+)?
ethanolate;4-ethyl-1H-inden-1-ide;titanium(4+) has a molecular weight of 326.26 g/mol, XLogP of 1.22, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanolate;4-ethyl-1H-inden-1-ide;titanium(4+) is sourced from PubChem (CID 159652722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).