C30H30N2O4 — CID 159653064
2-[[6-[[2,5-dihydroxy-3,6-dimethyl-4-(pyridin-3-ylmethyl)phenyl]methyl]-3-pyridinyl]methyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 159653064) has the molecular formula C30H30N2O4 and a molecular weight of 482.58 g/mol. Its IUPAC name is 2-[[6-[[2,5-dihydroxy-3,6-dimethyl-4-(pyridin-3-ylmethyl)phenyl]methyl]-3-pyridinyl]methyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[[6-[[2,5-dihydroxy-3,6-dimethyl-4-(pyridin-3-ylmethyl)phenyl]methyl]-3-pyridinyl]methyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 159653064 |
| Molecular Formula | C30H30N2O4 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | 2-[[6-[[2,5-dihydroxy-3,6-dimethyl-4-(pyridin-3-ylmethyl)phenyl]methyl]-3-pyridinyl]methyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(Cc2ccc(Cc3c(C)c(O)c(Cc4cccnc4)c(C)c3O)nc2)=C(C)C1=O |
| InChI | InChI=1S/C30H30N2O4/c1-16-17(2)28(34)24(18(3)27(16)33)12-22-8-9-23(32-15-22)13-26-20(5)29(35)25(19(4)30(26)36)11-21-7-6-10-31-14-21/h6-10,14-15,35-36H,11-13H2,1-5H3 |
| InChIKey | MRUZGFJIJGMXIO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|