C43H89N5 — CID 159653201
5,8-dimethyl-5-azaspiro[2.5]octane;1,2,4,6-tetramethylpiperidine;1,3,4,5-tetramethylpiperidine;1,2,4-trimethylpiperidine;1,3,4-trimethylpiperidine (PubChem CID 159653201) has the molecular formula C43H89N5 and a molecular weight of 676.22 g/mol. Its IUPAC name is 5,8-dimethyl-5-azaspiro[2.5]octane;1,2,4,6-tetramethylpiperidine;1,3,4,5-tetramethylpiperidine;1,2,4-trimethylpiperidine;1,3,4-trimethylpiperidine.
| Compound Name | 5,8-dimethyl-5-azaspiro[2.5]octane;1,2,4,6-tetramethylpiperidine;1,3,4,5-tetramethylpiperidine;1,2,4-trimethylpiperidine;1,3,4-trimethylpiperidine |
|---|---|
| PubChem CID | 159653201 |
| Molecular Formula | C43H89N5 |
| Molecular Weight | 676.22 g/mol |
| Exact Mass | 675.71 |
| IUPAC Name | 5,8-dimethyl-5-azaspiro[2.5]octane;1,2,4,6-tetramethylpiperidine;1,3,4,5-tetramethylpiperidine;1,2,4-trimethylpiperidine;1,3,4-trimethylpiperidine |
| SMILES | CC1CC(C)N(C)C(C)C1.CC1CCN(C)C(C)C1.CC1CCN(C)CC12CC2.CC1CCN(C)CC1C.CC1CN(C)CC(C)C1C |
| InChI | InChI=1S/C9H17N.2C9H19N.2C8H17N/c1-8-3-6-10(2)7-9(8)4-5-9;1-7-5-10(4)6-8(2)9(7)3;1-7-5-8(2)10(4)9(3)6-7;1-7-4-5-9(3)6-8(7)2;1-7-4-5-9(3)8(2)6-7/h8H,3-7H2,1-2H3;2*7-9H,5-6H2,1-4H3;2*7-8H,4-6H2,1-3H3 |
| InChIKey | MRVKLTPSUMQXTL-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 16.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.22 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |