C20H23N5O3 — CID 159654343
(3R,4R,5R)-2-(4-aminopyrazolo[1,5-a][1,3,5]triazin-8-yl)-5-ethyl-4-methyl-3-phenylmethoxyoxolane-3-carbaldehyde (PubChem CID 159654343) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is (3R,4R,5R)-2-(4-aminopyrazolo[1,5-a][1,3,5]triazin-8-yl)-5-ethyl-4-methyl-3-phenylmethoxyoxolane-3-carbaldehyde.
| Compound Name | (3R,4R,5R)-2-(4-aminopyrazolo[1,5-a][1,3,5]triazin-8-yl)-5-ethyl-4-methyl-3-phenylmethoxyoxolane-3-carbaldehyde |
|---|---|
| PubChem CID | 159654343 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | (3R,4R,5R)-2-(4-aminopyrazolo[1,5-a][1,3,5]triazin-8-yl)-5-ethyl-4-methyl-3-phenylmethoxyoxolane-3-carbaldehyde |
| SMILES | CC[C@H]1OC(c2cnn3c(N)ncnc23)[C@](C=O)(OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C20H23N5O3/c1-3-16-13(2)20(11-26,27-10-14-7-5-4-6-8-14)17(28-16)15-9-24-25-18(15)22-12-23-19(25)21/h4-9,11-13,16-17H,3,10H2,1-2H3,(H2,21,22,23)/t13-,16-,17?,20-/m1/s1 |
| InChIKey | RJACGPLTZKPLIY-COMXRSBISA-N |
| XLogP | 2.35 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|