C33H40N8 — CID 159654962
bis(4-[5-(7-azabicyclo[2.2.1]heptan-2-yl)-3-pyridinyl]pyridin-2-amine);methane (PubChem CID 159654962) has the molecular formula C33H40N8 and a molecular weight of 548.74 g/mol. Its IUPAC name is bis(4-[5-(7-azabicyclo[2.2.1]heptan-2-yl)-3-pyridinyl]pyridin-2-amine);methane.
| Compound Name | bis(4-[5-(7-azabicyclo[2.2.1]heptan-2-yl)-3-pyridinyl]pyridin-2-amine);methane |
|---|---|
| PubChem CID | 159654962 |
| Molecular Formula | C33H40N8 |
| Molecular Weight | 548.74 g/mol |
| Exact Mass | 548.34 |
| IUPAC Name | bis(4-[5-(7-azabicyclo[2.2.1]heptan-2-yl)-3-pyridinyl]pyridin-2-amine);methane |
| SMILES | C.Nc1cc(-c2cncc(C3CC4CCC3N4)c2)ccn1.Nc1cc(-c2cncc(C3CC4CCC3N4)c2)ccn1 |
| InChI | InChI=1S/2C16H18N4.CH4/c2*17-16-6-10(3-4-19-16)11-5-12(9-18-8-11)14-7-13-1-2-15(14)20-13;/h2*3-6,8-9,13-15,20H,1-2,7H2,(H2,17,19);1H4 |
| InChIKey | MSBBMVRSLYJHGW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 127.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.74 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |