C18H22N2O4 — CID 15965539
methyl (1R,3S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 15965539) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is methyl (1R,3S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl (1R,3S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 15965539 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | methyl (1R,3S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@H]([C@@H]2COC(C)(C)O2)N1 |
| InChI | InChI=1S/C18H22N2O4/c1-18(2)23-9-14(24-18)16-15-11(8-13(20-16)17(21)22-3)10-6-4-5-7-12(10)19-15/h4-7,13-14,16,19-20H,8-9H2,1-3H3/t13-,14-,16-/m0/s1 |
| InChIKey | UCVLEOQGUFDENX-DZKIICNBSA-N |
| XLogP | 2.05 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|