C12H16ClNO2 — CID 159655491
5-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid;chloromethane (PubChem CID 159655491) has the molecular formula C12H16ClNO2 and a molecular weight of 241.72 g/mol. Its IUPAC name is 5-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid;chloromethane.
| Compound Name | 5-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid;chloromethane |
|---|---|
| PubChem CID | 159655491 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 5-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid;chloromethane |
| SMILES | CCl.NC1CCCc2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C11H13NO2.CH3Cl/c12-10-3-1-2-7-6-8(11(13)14)4-5-9(7)10;1-2/h4-6,10H,1-3,12H2,(H,13,14);1H3 |
| InChIKey | MSCSOQKJAXIMSE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|