C20H22F4O6S2 — CID 15965593
[(2R,3S,4S,5R)-2,3,4,5-tetrafluoro-6-(4-methylphenyl)sulfonyloxyhexyl] 4-methylbenzenesulfonate (PubChem CID 15965593) has the molecular formula C20H22F4O6S2 and a molecular weight of 498.52 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-2,3,4,5-tetrafluoro-6-(4-methylphenyl)sulfonyloxyhexyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S,4S,5R)-2,3,4,5-tetrafluoro-6-(4-methylphenyl)sulfonyloxyhexyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15965593 |
| Molecular Formula | C20H22F4O6S2 |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | [(2R,3S,4S,5R)-2,3,4,5-tetrafluoro-6-(4-methylphenyl)sulfonyloxyhexyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](F)[C@H](F)[C@@H](F)[C@H](F)COS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H22F4O6S2/c1-13-3-7-15(8-4-13)31(25,26)29-11-17(21)19(23)20(24)18(22)12-30-32(27,28)16-9-5-14(2)6-10-16/h3-10,17-20H,11-12H2,1-2H3/t17-,18-,19+,20+/m1/s1 |
| InChIKey | AWRXHLZTYFQICP-ZRNYENFQSA-N |
| XLogP | 3.77 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|