C11H22O3P2 — CID 159656457
[(6S,8R,8aS)-6,7,8-trimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-2-yl]-methylphosphanylphosphane (PubChem CID 159656457) has the molecular formula C11H22O3P2 and a molecular weight of 264.24 g/mol. Its IUPAC name is [(6S,8R,8aS)-6,7,8-trimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-2-yl]-methylphosphanylphosphane.
| Compound Name | [(6S,8R,8aS)-6,7,8-trimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-2-yl]-methylphosphanylphosphane |
|---|---|
| PubChem CID | 159656457 |
| Molecular Formula | C11H22O3P2 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | [(6S,8R,8aS)-6,7,8-trimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-2-yl]-methylphosphanylphosphane |
| SMILES | CPPC1OCC2O[C@@H](C)C(C)[C@@H](C)[C@@H]2O1 |
| InChI | InChI=1S/C11H22O3P2/c1-6-7(2)10-9(13-8(6)3)5-12-11(14-10)16-15-4/h6-11,15-16H,5H2,1-4H3/t6?,7-,8+,9?,10+,11?/m1/s1 |
| InChIKey | PJZNVRUVCWFAHD-NDDVZBQSSA-N |
| XLogP | 2.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|