C26H23N3O4 — CID 15965653
(4S)-4-benzyl-2-[3-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]-5-nitrophenyl]-4,5-dihydro-1,3-oxazole (PubChem CID 15965653) has the molecular formula C26H23N3O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is (4S)-4-benzyl-2-[3-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]-5-nitrophenyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-4-benzyl-2-[3-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]-5-nitrophenyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 15965653 |
| Molecular Formula | C26H23N3O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | (4S)-4-benzyl-2-[3-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]-5-nitrophenyl]-4,5-dihydro-1,3-oxazole |
| SMILES | O=[N+]([O-])c1cc(C2=N[C@@H](Cc3ccccc3)CO2)cc(C2=N[C@@H](Cc3ccccc3)CO2)c1 |
| InChI | InChI=1S/C26H23N3O4/c30-29(31)24-14-20(25-27-22(16-32-25)11-18-7-3-1-4-8-18)13-21(15-24)26-28-23(17-33-26)12-19-9-5-2-6-10-19/h1-10,13-15,22-23H,11-12,16-17H2/t22-,23-/m0/s1 |
| InChIKey | IWWPZPXNFCEESM-GOTSBHOMSA-N |
| XLogP | 4.37 |
| TPSA | 86.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|