About bis[3-(trifluoromethoxy)phenyl]methanone;1-bromo-3-(trifluoromethoxy)benzene;methane
bis[3-(trifluoromethoxy)phenyl]methanone;1-bromo-3-(trifluoromethoxy)benzene;methane (PubChem CID 159656585) has the molecular formula C23H16BrF9O4
and a molecular weight of 607.26 g/mol. Its IUPAC name is bis[3-(trifluoromethoxy)phenyl]methanone;1-bromo-3-(trifluoromethoxy)benzene;methane.
Molecular Properties
| Compound Name | bis[3-(trifluoromethoxy)phenyl]methanone;1-bromo-3-(trifluoromethoxy)benzene;methane |
| PubChem CID | 159656585 |
| Molecular Formula | C23H16BrF9O4 |
| Molecular Weight | 607.26 g/mol |
| Exact Mass | 606.01 |
| IUPAC Name | bis[3-(trifluoromethoxy)phenyl]methanone;1-bromo-3-(trifluoromethoxy)benzene;methane |
| SMILES | C.FC(F)(F)Oc1cccc(Br)c1.O=C(c1cccc(OC(F)(F)F)c1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C15H8F6O3.C7H4BrF3O.CH4/c16-14(17,18)23-11-5-1-3-9(7-11)13(22)10-4-2-6-12(8-10)24-15(19,20)21;8-5-2-1-3-6(4-5)12-7(9,10)11;/h1-8H;1-4H;1H4 |
| InChIKey | MSGJABBAVBAJFH-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 607.26 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis[3-(trifluoromethoxy)phenyl]methanone;1-bromo-3-(trifluoromethoxy)benzene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[3-(trifluoromethoxy)phenyl]methanone;1-bromo-3-(trifluoromethoxy)benzene;methane?
The IUPAC name of bis[3-(trifluoromethoxy)phenyl]methanone;1-bromo-3-(trifluoromethoxy)benzene;methane (CID 159656585) is bis[3-(trifluoromethoxy)phenyl]methanone;1-bromo-3-(trifluoromethoxy)benzene;methane.
What is the SMILES notation for bis[3-(trifluoromethoxy)phenyl]methanone;1-bromo-3-(trifluoromethoxy)benzene;methane?
The canonical SMILES for bis[3-(trifluoromethoxy)phenyl]methanone;1-bromo-3-(trifluoromethoxy)benzene;methane is C.FC(F)(F)Oc1cccc(Br)c1.O=C(c1cccc(OC(F)(F)F)c1)c1cccc(OC(F)(F)F)c1.
What is the InChIKey of bis[3-(trifluoromethoxy)phenyl]methanone;1-bromo-3-(trifluoromethoxy)benzene;methane?
The InChIKey is MSGJABBAVBAJFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8F6O3.C7H4BrF3O.CH4/c16-14(17,18)23-11-5-1-3-9(7-11)13(22)10-4-2-6-12(8-10)24-15(19,20)21;8-5-2-1-3-6(4-5)12-7(9,10)11;/h1-8H;1-4H;1H4.
What are the key properties of bis[3-(trifluoromethoxy)phenyl]methanone;1-bromo-3-(trifluoromethoxy)benzene;methane?
bis[3-(trifluoromethoxy)phenyl]methanone;1-bromo-3-(trifluoromethoxy)benzene;methane has a molecular weight of 607.26 g/mol, XLogP of 8.70, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis[3-(trifluoromethoxy)phenyl]methanone;1-bromo-3-(trifluoromethoxy)benzene;methane is sourced from PubChem (CID 159656585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).