C23H28FN5 — CID 159657128
6-(2-cyclohexylethyl)-5-fluoro-N-methyl-N-[(3-pyrazol-1-ylphenyl)methyl]pyrimidin-4-amine (PubChem CID 159657128) has the molecular formula C23H28FN5 and a molecular weight of 393.51 g/mol. Its IUPAC name is 6-(2-cyclohexylethyl)-5-fluoro-N-methyl-N-[(3-pyrazol-1-ylphenyl)methyl]pyrimidin-4-amine.
| Compound Name | 6-(2-cyclohexylethyl)-5-fluoro-N-methyl-N-[(3-pyrazol-1-ylphenyl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 159657128 |
| Molecular Formula | C23H28FN5 |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 6-(2-cyclohexylethyl)-5-fluoro-N-methyl-N-[(3-pyrazol-1-ylphenyl)methyl]pyrimidin-4-amine |
| SMILES | CN(Cc1cccc(-n2cccn2)c1)c1ncnc(CCC2CCCCC2)c1F |
| InChI | InChI=1S/C23H28FN5/c1-28(16-19-9-5-10-20(15-19)29-14-6-13-27-29)23-22(24)21(25-17-26-23)12-11-18-7-3-2-4-8-18/h5-6,9-10,13-15,17-18H,2-4,7-8,11-12,16H2,1H3 |
| InChIKey | HALZIVNJQDKBPS-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |