C12H22O2Si — CID 15965749
[(3aS,4S,7aS)-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl]-trimethylsilane (PubChem CID 15965749) has the molecular formula C12H22O2Si and a molecular weight of 226.39 g/mol. Its IUPAC name is [(3aS,4S,7aS)-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl]-trimethylsilane.
| Compound Name | [(3aS,4S,7aS)-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 15965749 |
| Molecular Formula | C12H22O2Si |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | [(3aS,4S,7aS)-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl]-trimethylsilane |
| SMILES | CC1(C)O[C@H]2[C@H](CC=C[C@@H]2[Si](C)(C)C)O1 |
| InChI | InChI=1S/C12H22O2Si/c1-12(2)13-9-7-6-8-10(11(9)14-12)15(3,4)5/h6,8-11H,7H2,1-5H3/t9-,10-,11-/m0/s1 |
| InChIKey | UZUCLUJHQUWHQJ-DCAQKATOSA-N |
| XLogP | 3.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|