About CID 15965783
CID 15965783 (PubChem CID 15965783) has the molecular formula C33H31ClN4SiTi+
and a molecular weight of 595.05 g/mol.
Molecular Properties
| Compound Name | CID 15965783 |
| PubChem CID | 15965783 |
| Molecular Formula | C33H31ClN4SiTi+ |
| Molecular Weight | 595.05 g/mol |
| Exact Mass | 594.15 |
| IUPAC Name | — |
| SMILES | C[Si](C)([N-]/C(=N/c1ccccc1)c1ccccc1)N(C(=[N-])c1ccccc1)c1ccccc1.Cl[Ti+3].[CH]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C28H26N4Si.C5H5.ClH.Ti/c1-33(2,31-28(24-17-9-4-10-18-24)30-25-19-11-5-12-20-25)32(26-21-13-6-14-22-26)27(29)23-15-7-3-8-16-23;1-2-4-5-3-1;;/h3-22H,1-2H3;1-5H;1H;/q-2;;;+4/p-1 |
| InChIKey | BNUFJUYRGPWKPQ-UHFFFAOYSA-M |
| XLogP | 9.07 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 595.05 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze CID 15965783 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 15965783?
The IUPAC name of CID 15965783 (CID 15965783) is not available.
What is the SMILES notation for CID 15965783?
The canonical SMILES for CID 15965783 is C[Si](C)([N-]/C(=N/c1ccccc1)c1ccccc1)N(C(=[N-])c1ccccc1)c1ccccc1.Cl[Ti+3].[CH]1[CH][CH][CH][CH]1.
What is the InChIKey of CID 15965783?
The InChIKey is BNUFJUYRGPWKPQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C28H26N4Si.C5H5.ClH.Ti/c1-33(2,31-28(24-17-9-4-10-18-24)30-25-19-11-5-12-20-25)32(26-21-13-6-14-22-26)27(29)23-15-7-3-8-16-23;1-2-4-5-3-1;;/h3-22H,1-2H3;1-5H;1H;/q-2;;;+4/p-1.
What are the key properties of CID 15965783?
CID 15965783 has a molecular weight of 595.05 g/mol, XLogP of 9.07, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 15965783 is sourced from PubChem (CID 15965783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).