About benzoyl benzenecarboperoxoate;hexyl 2-ethylhexaneperoxoate
benzoyl benzenecarboperoxoate;hexyl 2-ethylhexaneperoxoate (PubChem CID 159658456) has the molecular formula C28H38O7
and a molecular weight of 486.61 g/mol. Its IUPAC name is benzoyl benzenecarboperoxoate;hexyl 2-ethylhexaneperoxoate.
Molecular Properties
| Compound Name | benzoyl benzenecarboperoxoate;hexyl 2-ethylhexaneperoxoate |
| PubChem CID | 159658456 |
| Molecular Formula | C28H38O7 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | benzoyl benzenecarboperoxoate;hexyl 2-ethylhexaneperoxoate |
| SMILES | CCCCCCOOC(=O)C(CC)CCCC.O=C(OOC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H10O4.C14H28O3/c15-13(11-7-3-1-4-8-11)17-18-14(16)12-9-5-2-6-10-12;1-4-7-9-10-12-16-17-14(15)13(6-3)11-8-5-2/h1-10H;13H,4-12H2,1-3H3 |
| InChIKey | MSMAUFZCDUFBEP-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze benzoyl benzenecarboperoxoate;hexyl 2-ethylhexaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoyl benzenecarboperoxoate;hexyl 2-ethylhexaneperoxoate?
The IUPAC name of benzoyl benzenecarboperoxoate;hexyl 2-ethylhexaneperoxoate (CID 159658456) is benzoyl benzenecarboperoxoate;hexyl 2-ethylhexaneperoxoate.
What is the SMILES notation for benzoyl benzenecarboperoxoate;hexyl 2-ethylhexaneperoxoate?
The canonical SMILES for benzoyl benzenecarboperoxoate;hexyl 2-ethylhexaneperoxoate is CCCCCCOOC(=O)C(CC)CCCC.O=C(OOC(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of benzoyl benzenecarboperoxoate;hexyl 2-ethylhexaneperoxoate?
The InChIKey is MSMAUFZCDUFBEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O4.C14H28O3/c15-13(11-7-3-1-4-8-11)17-18-14(16)12-9-5-2-6-10-12;1-4-7-9-10-12-16-17-14(15)13(6-3)11-8-5-2/h1-10H;13H,4-12H2,1-3H3.
What are the key properties of benzoyl benzenecarboperoxoate;hexyl 2-ethylhexaneperoxoate?
benzoyl benzenecarboperoxoate;hexyl 2-ethylhexaneperoxoate has a molecular weight of 486.61 g/mol, XLogP of 6.87, 13 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for benzoyl benzenecarboperoxoate;hexyl 2-ethylhexaneperoxoate is sourced from PubChem (CID 159658456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).