C26H42O11P2 — CID 159658809
5-(dimethoxyphosphorylmethyl)-2,2-diphenyl-1,3-dioxane;2-(dimethoxyphosphorylmethyl)propane-1,3-diol;methanol (PubChem CID 159658809) has the molecular formula C26H42O11P2 and a molecular weight of 592.56 g/mol. Its IUPAC name is 5-(dimethoxyphosphorylmethyl)-2,2-diphenyl-1,3-dioxane;2-(dimethoxyphosphorylmethyl)propane-1,3-diol;methanol.
| Compound Name | 5-(dimethoxyphosphorylmethyl)-2,2-diphenyl-1,3-dioxane;2-(dimethoxyphosphorylmethyl)propane-1,3-diol;methanol |
|---|---|
| PubChem CID | 159658809 |
| Molecular Formula | C26H42O11P2 |
| Molecular Weight | 592.56 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | 5-(dimethoxyphosphorylmethyl)-2,2-diphenyl-1,3-dioxane;2-(dimethoxyphosphorylmethyl)propane-1,3-diol;methanol |
| SMILES | CO.COP(=O)(CC(CO)CO)OC.COP(=O)(CC1COC(c2ccccc2)(c2ccccc2)OC1)OC |
| InChI | InChI=1S/C19H23O5P.C6H15O5P.CH4O/c1-21-25(20,22-2)15-16-13-23-19(24-14-16,17-9-5-3-6-10-17)18-11-7-4-8-12-18;1-10-12(9,11-2)5-6(3-7)4-8;1-2/h3-12,16H,13-15H2,1-2H3;6-8H,3-5H2,1-2H3;2H,1H3 |
| InChIKey | MSNGNRNNEBWDQN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 150.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|