C18H29N3O2S — CID 159659028
N-hexyl-4-[(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)sulfanyl]butanamide (PubChem CID 159659028) has the molecular formula C18H29N3O2S and a molecular weight of 351.52 g/mol. Its IUPAC name is N-hexyl-4-[(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)sulfanyl]butanamide.
| Compound Name | N-hexyl-4-[(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)sulfanyl]butanamide |
|---|---|
| PubChem CID | 159659028 |
| Molecular Formula | C18H29N3O2S |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | N-hexyl-4-[(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)sulfanyl]butanamide |
| SMILES | CCCCCCNC(=O)CCCSc1nc2c(c(=O)[nH]1)CCCC2 |
| InChI | InChI=1S/C18H29N3O2S/c1-2-3-4-7-12-19-16(22)11-8-13-24-18-20-15-10-6-5-9-14(15)17(23)21-18/h2-13H2,1H3,(H,19,22)(H,20,21,23) |
| InChIKey | HMDYLISESBKJCU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|