C16H28N4O2 — CID 159659272
1-butoxy-3-(2-ethyl-4-methylimidazol-1-yl)propan-2-ol;1H-imidazole (PubChem CID 159659272) has the molecular formula C16H28N4O2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 1-butoxy-3-(2-ethyl-4-methylimidazol-1-yl)propan-2-ol;1H-imidazole.
| Compound Name | 1-butoxy-3-(2-ethyl-4-methylimidazol-1-yl)propan-2-ol;1H-imidazole |
|---|---|
| PubChem CID | 159659272 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 1-butoxy-3-(2-ethyl-4-methylimidazol-1-yl)propan-2-ol;1H-imidazole |
| SMILES | CCCCOCC(O)Cn1cc(C)nc1CC.c1c[nH]cn1 |
| InChI | InChI=1S/C13H24N2O2.C3H4N2/c1-4-6-7-17-10-12(16)9-15-8-11(3)14-13(15)5-2;1-2-5-3-4-1/h8,12,16H,4-7,9-10H2,1-3H3;1-3H,(H,4,5) |
| InChIKey | MSOYDPYCMYIHEG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|