About propanethioamide;pyridine
propanethioamide;pyridine (PubChem CID 159661504) has the molecular formula C11H19N3S2
and a molecular weight of 257.43 g/mol. Its IUPAC name is propanethioamide;pyridine.
Molecular Properties
| Compound Name | propanethioamide;pyridine |
| PubChem CID | 159661504 |
| Molecular Formula | C11H19N3S2 |
| Molecular Weight | 257.43 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | propanethioamide;pyridine |
| SMILES | CCC(N)=S.CCC(N)=S.c1ccncc1 |
| InChI | InChI=1S/C5H5N.2C3H7NS/c1-2-4-6-5-3-1;2*1-2-3(4)5/h1-5H;2*2H2,1H3,(H2,4,5) |
| InChIKey | MSWDMSPXCFVXTC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze propanethioamide;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanethioamide;pyridine?
The IUPAC name of propanethioamide;pyridine (CID 159661504) is propanethioamide;pyridine.
What is the SMILES notation for propanethioamide;pyridine?
The canonical SMILES for propanethioamide;pyridine is CCC(N)=S.CCC(N)=S.c1ccncc1.
What is the InChIKey of propanethioamide;pyridine?
The InChIKey is MSWDMSPXCFVXTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N.2C3H7NS/c1-2-4-6-5-3-1;2*1-2-3(4)5/h1-5H;2*2H2,1H3,(H2,4,5).
What are the key properties of propanethioamide;pyridine?
propanethioamide;pyridine has a molecular weight of 257.43 g/mol, XLogP of 2.45, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propanethioamide;pyridine is sourced from PubChem (CID 159661504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).