C29H46N2O5 — CID 159661609
[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (3S)-4-methyl-3-[1-(2-methylpropyl)imidazol-4-yl]pentanoate (PubChem CID 159661609) has the molecular formula C29H46N2O5 and a molecular weight of 502.70 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (3S)-4-methyl-3-[1-(2-methylpropyl)imidazol-4-yl]pentanoate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (3S)-4-methyl-3-[1-(2-methylpropyl)imidazol-4-yl]pentanoate |
|---|---|
| PubChem CID | 159661609 |
| Molecular Formula | C29H46N2O5 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.34 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (3S)-4-methyl-3-[1-(2-methylpropyl)imidazol-4-yl]pentanoate |
| SMILES | CO[C@@H]1[C@H](OC(=O)C[C@H](c2cn(CC(C)C)cn2)C(C)C)CC[C@]2(CO2)[C@H]1[C@@]1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C29H46N2O5/c1-18(2)9-10-24-28(7,36-24)27-26(33-8)23(11-12-29(27)16-34-29)35-25(32)13-21(20(5)6)22-15-31(17-30-22)14-19(3)4/h9,15,17,19-21,23-24,26-27H,10-14,16H2,1-8H3/t21-,23+,24+,26+,27+,28-,29-/m0/s1 |
| InChIKey | MSWLXCIMOYAASI-DBZBCYJNSA-N |
| XLogP | 5.29 |
| TPSA | 78.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|