C34H40 — CID 159661807
6-[2-[2,6-dimethyl-4-(2,4,6-trimethylphenyl)phenyl]propan-2-yl]-1,2,3,8-tetramethylnaphthalene (PubChem CID 159661807) has the molecular formula C34H40 and a molecular weight of 448.69 g/mol. Its IUPAC name is 6-[2-[2,6-dimethyl-4-(2,4,6-trimethylphenyl)phenyl]propan-2-yl]-1,2,3,8-tetramethylnaphthalene.
| Compound Name | 6-[2-[2,6-dimethyl-4-(2,4,6-trimethylphenyl)phenyl]propan-2-yl]-1,2,3,8-tetramethylnaphthalene |
|---|---|
| PubChem CID | 159661807 |
| Molecular Formula | C34H40 |
| Molecular Weight | 448.69 g/mol |
| Exact Mass | 448.31 |
| IUPAC Name | 6-[2-[2,6-dimethyl-4-(2,4,6-trimethylphenyl)phenyl]propan-2-yl]-1,2,3,8-tetramethylnaphthalene |
| SMILES | Cc1cc(C)c(-c2cc(C)c(C(C)(C)c3cc(C)c4c(C)c(C)c(C)cc4c3)c(C)c2)c(C)c1 |
| InChI | InChI=1S/C34H40/c1-19-12-21(3)31(22(4)13-19)28-15-24(6)33(25(7)16-28)34(10,11)30-17-23(5)32-27(9)26(8)20(2)14-29(32)18-30/h12-18H,1-11H3 |
| InChIKey | VBXGNSOXOIUOGB-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.69 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |